C44H53BN2 — CID 168814071
4,18-ditert-butyl-14-(4-tert-butylphenyl)-11-methyl-8-(4-methylphenyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,10,12,16,18-heptaene (PubChem CID 168814071) has the molecular formula C44H53BN2 and a molecular weight of 620.73 g/mol. Its IUPAC name is 4,18-ditert-butyl-14-(4-tert-butylphenyl)-11-methyl-8-(4-methylphenyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,10,12,16,18-heptaene.
| Compound Name | 4,18-ditert-butyl-14-(4-tert-butylphenyl)-11-methyl-8-(4-methylphenyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,10,12,16,18-heptaene |
|---|---|
| PubChem CID | 168814071 |
| Molecular Formula | C44H53BN2 |
| Molecular Weight | 620.73 g/mol |
| Exact Mass | 620.43 |
| IUPAC Name | 4,18-ditert-butyl-14-(4-tert-butylphenyl)-11-methyl-8-(4-methylphenyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,10,12,16,18-heptaene |
| SMILES | CC1=CC2C3B(c4cc(C(C)(C)C)ccc4N2c2ccc(C)cc2)C2C=C(C(C)(C)C)C=CC2N(c2ccc(C(C)(C)C)cc2)C3=C1 |
| InChI | InChI=1S/C44H53BN2/c1-28-12-18-33(19-13-28)46-37-22-16-31(43(6,7)8)26-35(37)45-36-27-32(44(9,10)11)17-23-38(36)47(40-25-29(2)24-39(46)41(40)45)34-20-14-30(15-21-34)42(3,4)5/h12-27,36,38-39,41H,1-11H3 |
| InChIKey | DRCSUXAAWUNJKB-UHFFFAOYSA-N |
| XLogP | 10.83 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.73 |
| LogP ≤ 5 | 10.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|