C28H26F3N5O3 — CID 176827402
benzyl 1-[[(1R)-1-[3-(difluoromethyl)-2-fluorophenyl]ethyl]amino]-3-methyl-6-oxo-5,7,9,10-tetrahydropyrimido[5,4-f][2,7]naphthyridine-8-carboxylate (PubChem CID 176827402) has the molecular formula C28H26F3N5O3 and a molecular weight of 537.54 g/mol. Its IUPAC name is benzyl 1-[[(1R)-1-[3-(difluoromethyl)-2-fluorophenyl]ethyl]amino]-3-methyl-6-oxo-5,7,9,10-tetrahydropyrimido[5,4-f][2,7]naphthyridine-8-carboxylate.
| Compound Name | benzyl 1-[[(1R)-1-[3-(difluoromethyl)-2-fluorophenyl]ethyl]amino]-3-methyl-6-oxo-5,7,9,10-tetrahydropyrimido[5,4-f][2,7]naphthyridine-8-carboxylate |
|---|---|
| PubChem CID | 176827402 |
| Molecular Formula | C28H26F3N5O3 |
| Molecular Weight | 537.54 g/mol |
| Exact Mass | 537.20 |
| IUPAC Name | benzyl 1-[[(1R)-1-[3-(difluoromethyl)-2-fluorophenyl]ethyl]amino]-3-methyl-6-oxo-5,7,9,10-tetrahydropyrimido[5,4-f][2,7]naphthyridine-8-carboxylate |
| SMILES | Cc1nc(N[C@H](C)c2cccc(C(F)F)c2F)c2c3c(c(=O)[nH]c2n1)CN(C(=O)OCc1ccccc1)CC3 |
| InChI | InChI=1S/C28H26F3N5O3/c1-15(18-9-6-10-20(23(18)29)24(30)31)32-25-22-19-11-12-36(28(38)39-14-17-7-4-3-5-8-17)13-21(19)27(37)35-26(22)34-16(2)33-25/h3-10,15,24H,11-14H2,1-2H3,(H2,32,33,34,35,37)/t15-/m1/s1 |
| InChIKey | TZKWLDKHCDYQBR-OAHLLOKOSA-N |
| XLogP | 5.57 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.54 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |