C40H34ClNO2 — CID 176828409
3-[3-tert-butyl-5-(3-chlorophenoxy)-N-(2,6-diphenylphenyl)anilino]phenol (PubChem CID 176828409) has the molecular formula C40H34ClNO2 and a molecular weight of 596.17 g/mol. Its IUPAC name is 3-[3-tert-butyl-5-(3-chlorophenoxy)-N-(2,6-diphenylphenyl)anilino]phenol.
| Compound Name | 3-[3-tert-butyl-5-(3-chlorophenoxy)-N-(2,6-diphenylphenyl)anilino]phenol |
|---|---|
| PubChem CID | 176828409 |
| Molecular Formula | C40H34ClNO2 |
| Molecular Weight | 596.17 g/mol |
| Exact Mass | 595.23 |
| IUPAC Name | 3-[3-tert-butyl-5-(3-chlorophenoxy)-N-(2,6-diphenylphenyl)anilino]phenol |
| SMILES | CC(C)(C)c1cc(Oc2cccc(Cl)c2)cc(N(c2cccc(O)c2)c2c(-c3ccccc3)cccc2-c2ccccc2)c1 |
| InChI | InChI=1S/C40H34ClNO2/c1-40(2,3)30-23-33(27-36(24-30)44-35-20-10-17-31(41)25-35)42(32-18-11-19-34(43)26-32)39-37(28-13-6-4-7-14-28)21-12-22-38(39)29-15-8-5-9-16-29/h4-27,43H,1-3H3 |
| InChIKey | KCDPJLPWCSNIPS-UHFFFAOYSA-N |
| XLogP | 11.94 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.17 |
| LogP ≤ 5 | 11.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |