C19H20ClN5O2 — CID 176828923
1-[5-[(2-tert-butyl-6-chlorophenyl)methoxy]pyrimidin-2-yl]pyrazole-3-carboxamide (PubChem CID 176828923) has the molecular formula C19H20ClN5O2 and a molecular weight of 385.86 g/mol. Its IUPAC name is 1-[5-[(2-tert-butyl-6-chlorophenyl)methoxy]pyrimidin-2-yl]pyrazole-3-carboxamide.
| Compound Name | 1-[5-[(2-tert-butyl-6-chlorophenyl)methoxy]pyrimidin-2-yl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 176828923 |
| Molecular Formula | C19H20ClN5O2 |
| Molecular Weight | 385.86 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | 1-[5-[(2-tert-butyl-6-chlorophenyl)methoxy]pyrimidin-2-yl]pyrazole-3-carboxamide |
| SMILES | CC(C)(C)c1cccc(Cl)c1COc1cnc(-n2ccc(C(N)=O)n2)nc1 |
| InChI | InChI=1S/C19H20ClN5O2/c1-19(2,3)14-5-4-6-15(20)13(14)11-27-12-9-22-18(23-10-12)25-8-7-16(24-25)17(21)26/h4-10H,11H2,1-3H3,(H2,21,26) |
| InChIKey | IYGHTCSYOUZOCY-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.86 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |