C19H21ClN4O2 — CID 176829001
[1-[5-[(2-tert-butyl-6-chlorophenyl)methoxy]pyrimidin-2-yl]pyrazol-3-yl]methanol (PubChem CID 176829001) has the molecular formula C19H21ClN4O2 and a molecular weight of 372.86 g/mol. Its IUPAC name is [1-[5-[(2-tert-butyl-6-chlorophenyl)methoxy]pyrimidin-2-yl]pyrazol-3-yl]methanol.
| Compound Name | [1-[5-[(2-tert-butyl-6-chlorophenyl)methoxy]pyrimidin-2-yl]pyrazol-3-yl]methanol |
|---|---|
| PubChem CID | 176829001 |
| Molecular Formula | C19H21ClN4O2 |
| Molecular Weight | 372.86 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | [1-[5-[(2-tert-butyl-6-chlorophenyl)methoxy]pyrimidin-2-yl]pyrazol-3-yl]methanol |
| SMILES | CC(C)(C)c1cccc(Cl)c1COc1cnc(-n2ccc(CO)n2)nc1 |
| InChI | InChI=1S/C19H21ClN4O2/c1-19(2,3)16-5-4-6-17(20)15(16)12-26-14-9-21-18(22-10-14)24-8-7-13(11-25)23-24/h4-10,25H,11-12H2,1-3H3 |
| InChIKey | PMFIOYLIEADCKP-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.86 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |