C8H8Cl2O — CID 176829062
1,3-dichloro-2-[dideuterio(methoxy)methyl]benzene (PubChem CID 176829062) has the molecular formula C8H8Cl2O and a molecular weight of 193.07 g/mol. Its IUPAC name is 1,3-dichloro-2-[dideuterio(methoxy)methyl]benzene.
| Compound Name | 1,3-dichloro-2-[dideuterio(methoxy)methyl]benzene |
|---|---|
| PubChem CID | 176829062 |
| Molecular Formula | C8H8Cl2O |
| Molecular Weight | 193.07 g/mol |
| Exact Mass | 192.01 |
| IUPAC Name | 1,3-dichloro-2-[dideuterio(methoxy)methyl]benzene |
| SMILES | [2H]C([2H])(OC)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C8H8Cl2O/c1-11-5-6-7(9)3-2-4-8(6)10/h2-4H,5H2,1H3/i5D2 |
| InChIKey | QBKBHXIQLAMKOB-BFWBPSQCSA-N |
| XLogP | 3.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.07 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |