C10H13Cl2NO2 — CID 170043449
N-[2-[(2,6-dichlorophenyl)methoxy]ethoxy]methanamine (PubChem CID 170043449) has the molecular formula C10H13Cl2NO2 and a molecular weight of 250.12 g/mol. Its IUPAC name is N-[2-[(2,6-dichlorophenyl)methoxy]ethoxy]methanamine.
| Compound Name | N-[2-[(2,6-dichlorophenyl)methoxy]ethoxy]methanamine |
|---|---|
| PubChem CID | 170043449 |
| Molecular Formula | C10H13Cl2NO2 |
| Molecular Weight | 250.12 g/mol |
| Exact Mass | 249.03 |
| IUPAC Name | N-[2-[(2,6-dichlorophenyl)methoxy]ethoxy]methanamine |
| SMILES | CNOCCOCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C10H13Cl2NO2/c1-13-15-6-5-14-7-8-9(11)3-2-4-10(8)12/h2-4,13H,5-7H2,1H3 |
| InChIKey | WNSNRPOECGXUJV-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.12 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|