C16H22Cl2O3 — CID 141399860
6-[2-[(2,6-dichlorophenyl)methoxy]ethoxy]-2-methylhexanal (PubChem CID 141399860) has the molecular formula C16H22Cl2O3 and a molecular weight of 333.26 g/mol. Its IUPAC name is 6-[2-[(2,6-dichlorophenyl)methoxy]ethoxy]-2-methylhexanal.
| Compound Name | 6-[2-[(2,6-dichlorophenyl)methoxy]ethoxy]-2-methylhexanal |
|---|---|
| PubChem CID | 141399860 |
| Molecular Formula | C16H22Cl2O3 |
| Molecular Weight | 333.26 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | 6-[2-[(2,6-dichlorophenyl)methoxy]ethoxy]-2-methylhexanal |
| SMILES | CC(C=O)CCCCOCCOCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C16H22Cl2O3/c1-13(11-19)5-2-3-8-20-9-10-21-12-14-15(17)6-4-7-16(14)18/h4,6-7,11,13H,2-3,5,8-10,12H2,1H3 |
| InChIKey | CXBALJUGGNNFOB-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.26 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|