About 2-[2-(2-hydroxyethoxy)ethoxy]ethanol;2-methylundecanal
2-[2-(2-hydroxyethoxy)ethoxy]ethanol;2-methylundecanal (PubChem CID 86639480) has the molecular formula C18H38O5
and a molecular weight of 334.50 g/mol. Its IUPAC name is 2-[2-(2-hydroxyethoxy)ethoxy]ethanol;2-methylundecanal.
Molecular Properties
| Compound Name | 2-[2-(2-hydroxyethoxy)ethoxy]ethanol;2-methylundecanal |
| PubChem CID | 86639480 |
| Molecular Formula | C18H38O5 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.27 |
| IUPAC Name | 2-[2-(2-hydroxyethoxy)ethoxy]ethanol;2-methylundecanal |
| SMILES | CCCCCCCCCC(C)C=O.OCCOCCOCCO |
| InChI | InChI=1S/C12H24O.C6H14O4/c1-3-4-5-6-7-8-9-10-12(2)11-13;7-1-3-9-5-6-10-4-2-8/h11-12H,3-10H2,1-2H3;7-8H,1-6H2 |
| InChIKey | NQVAXDNFQHHDCB-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(2-hydroxyethoxy)ethoxy]ethanol;2-methylundecanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2-hydroxyethoxy)ethoxy]ethanol;2-methylundecanal?
The IUPAC name of 2-[2-(2-hydroxyethoxy)ethoxy]ethanol;2-methylundecanal (CID 86639480) is 2-[2-(2-hydroxyethoxy)ethoxy]ethanol;2-methylundecanal.
What is the SMILES notation for 2-[2-(2-hydroxyethoxy)ethoxy]ethanol;2-methylundecanal?
The canonical SMILES for 2-[2-(2-hydroxyethoxy)ethoxy]ethanol;2-methylundecanal is CCCCCCCCCC(C)C=O.OCCOCCOCCO.
What is the InChIKey of 2-[2-(2-hydroxyethoxy)ethoxy]ethanol;2-methylundecanal?
The InChIKey is NQVAXDNFQHHDCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O.C6H14O4/c1-3-4-5-6-7-8-9-10-12(2)11-13;7-1-3-9-5-6-10-4-2-8/h11-12H,3-10H2,1-2H3;7-8H,1-6H2.
What are the key properties of 2-[2-(2-hydroxyethoxy)ethoxy]ethanol;2-methylundecanal?
2-[2-(2-hydroxyethoxy)ethoxy]ethanol;2-methylundecanal has a molecular weight of 334.50 g/mol, XLogP of 2.97, 16 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2-hydroxyethoxy)ethoxy]ethanol;2-methylundecanal is sourced from PubChem (CID 86639480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).