C17H26Cl2O2 — CID 90905849
1,3-dichloro-2-[2-(3,3,4-trimethylpentoxy)ethoxymethyl]benzene (PubChem CID 90905849) has the molecular formula C17H26Cl2O2 and a molecular weight of 333.30 g/mol. Its IUPAC name is 1,3-dichloro-2-[2-(3,3,4-trimethylpentoxy)ethoxymethyl]benzene.
| Compound Name | 1,3-dichloro-2-[2-(3,3,4-trimethylpentoxy)ethoxymethyl]benzene |
|---|---|
| PubChem CID | 90905849 |
| Molecular Formula | C17H26Cl2O2 |
| Molecular Weight | 333.30 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 1,3-dichloro-2-[2-(3,3,4-trimethylpentoxy)ethoxymethyl]benzene |
| SMILES | CC(C)C(C)(C)CCOCCOCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C17H26Cl2O2/c1-13(2)17(3,4)8-9-20-10-11-21-12-14-15(18)6-5-7-16(14)19/h5-7,13H,8-12H2,1-4H3 |
| InChIKey | VJENTWSQDYKZCC-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.30 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|