C16H25NO5S — CID 176829931
8-O-tert-butyl 4-O-methyl 2-methyl-3-oxo-1-thia-8-azaspiro[4.5]decane-4,8-dicarboxylate (PubChem CID 176829931) has the molecular formula C16H25NO5S and a molecular weight of 343.45 g/mol. Its IUPAC name is 8-O-tert-butyl 4-O-methyl 2-methyl-3-oxo-1-thia-8-azaspiro[4.5]decane-4,8-dicarboxylate.
| Compound Name | 8-O-tert-butyl 4-O-methyl 2-methyl-3-oxo-1-thia-8-azaspiro[4.5]decane-4,8-dicarboxylate |
|---|---|
| PubChem CID | 176829931 |
| Molecular Formula | C16H25NO5S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 8-O-tert-butyl 4-O-methyl 2-methyl-3-oxo-1-thia-8-azaspiro[4.5]decane-4,8-dicarboxylate |
| SMILES | COC(=O)C1C(=O)C(C)SC12CCN(C(=O)OC(C)(C)C)CC2 |
| InChI | InChI=1S/C16H25NO5S/c1-10-12(18)11(13(19)21-5)16(23-10)6-8-17(9-7-16)14(20)22-15(2,3)4/h10-11H,6-9H2,1-5H3 |
| InChIKey | COLYAKJIAVTQMT-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|