C21H23ClO2S — CID 176831789
1-[(2Z,5E)-2-(2-chloroethyl)-6-phenylhexa-2,5-dienyl]sulfonyl-4-methylbenzene (PubChem CID 176831789) has the molecular formula C21H23ClO2S and a molecular weight of 374.93 g/mol. Its IUPAC name is 1-[(2Z,5E)-2-(2-chloroethyl)-6-phenylhexa-2,5-dienyl]sulfonyl-4-methylbenzene.
| Compound Name | 1-[(2Z,5E)-2-(2-chloroethyl)-6-phenylhexa-2,5-dienyl]sulfonyl-4-methylbenzene |
|---|---|
| PubChem CID | 176831789 |
| Molecular Formula | C21H23ClO2S |
| Molecular Weight | 374.93 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | 1-[(2Z,5E)-2-(2-chloroethyl)-6-phenylhexa-2,5-dienyl]sulfonyl-4-methylbenzene |
| SMILES | Cc1ccc(S(=O)(=O)C/C(=C\C/C=C/c2ccccc2)CCCl)cc1 |
| InChI | InChI=1S/C21H23ClO2S/c1-18-11-13-21(14-12-18)25(23,24)17-20(15-16-22)10-6-5-9-19-7-3-2-4-8-19/h2-5,7-14H,6,15-17H2,1H3/b9-5+,20-10- |
| InChIKey | OSSXWBRGQRAQCB-DXQMBWDBSA-N |
| XLogP | 5.43 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.93 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|