C18H29N3O2 — CID 176835406
butyl N-(4-cyclobutyl-5-cyclopentyl-2-methylpyrazol-3-yl)carbamate (PubChem CID 176835406) has the molecular formula C18H29N3O2 and a molecular weight of 319.45 g/mol. Its IUPAC name is butyl N-(4-cyclobutyl-5-cyclopentyl-2-methylpyrazol-3-yl)carbamate.
| Compound Name | butyl N-(4-cyclobutyl-5-cyclopentyl-2-methylpyrazol-3-yl)carbamate |
|---|---|
| PubChem CID | 176835406 |
| Molecular Formula | C18H29N3O2 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.23 |
| IUPAC Name | butyl N-(4-cyclobutyl-5-cyclopentyl-2-methylpyrazol-3-yl)carbamate |
| SMILES | CCCCOC(=O)Nc1c(C2CCC2)c(C2CCCC2)nn1C |
| InChI | InChI=1S/C18H29N3O2/c1-3-4-12-23-18(22)19-17-15(13-10-7-11-13)16(20-21(17)2)14-8-5-6-9-14/h13-14H,3-12H2,1-2H3,(H,19,22) |
| InChIKey | ZDURFVWJSXUMFH-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|