C15H17O8- — CID 176837731
4-[3-(2-methylprop-2-enoyloxy)propanoyloxy]-7-oxo-6-oxabicyclo[3.2.1]octane-2-carboxylate (PubChem CID 176837731) has the molecular formula C15H17O8- and a molecular weight of 325.29 g/mol. Its IUPAC name is 4-[3-(2-methylprop-2-enoyloxy)propanoyloxy]-7-oxo-6-oxabicyclo[3.2.1]octane-2-carboxylate.
| Compound Name | 4-[3-(2-methylprop-2-enoyloxy)propanoyloxy]-7-oxo-6-oxabicyclo[3.2.1]octane-2-carboxylate |
|---|---|
| PubChem CID | 176837731 |
| Molecular Formula | C15H17O8- |
| Molecular Weight | 325.29 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | 4-[3-(2-methylprop-2-enoyloxy)propanoyloxy]-7-oxo-6-oxabicyclo[3.2.1]octane-2-carboxylate |
| SMILES | C=C(C)C(=O)OCCC(=O)OC1CC(C(=O)[O-])C2CC1OC2=O |
| InChI | InChI=1S/C15H18O8/c1-7(2)14(19)21-4-3-12(16)22-10-5-8(13(17)18)9-6-11(10)23-15(9)20/h8-11H,1,3-6H2,2H3,(H,17,18)/p-1 |
| InChIKey | MKWCEGQEXOYRTN-UHFFFAOYSA-M |
| XLogP | -0.89 |
| TPSA | 119.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.29 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|