C20H28O6 — CID 89204018
(1-ethylcyclohexyl) 4-(2-methylprop-2-enoyloxy)-7-oxo-6-oxabicyclo[3.2.1]octane-2-carboxylate (PubChem CID 89204018) has the molecular formula C20H28O6 and a molecular weight of 364.44 g/mol. Its IUPAC name is (1-ethylcyclohexyl) 4-(2-methylprop-2-enoyloxy)-7-oxo-6-oxabicyclo[3.2.1]octane-2-carboxylate.
| Compound Name | (1-ethylcyclohexyl) 4-(2-methylprop-2-enoyloxy)-7-oxo-6-oxabicyclo[3.2.1]octane-2-carboxylate |
|---|---|
| PubChem CID | 89204018 |
| Molecular Formula | C20H28O6 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | (1-ethylcyclohexyl) 4-(2-methylprop-2-enoyloxy)-7-oxo-6-oxabicyclo[3.2.1]octane-2-carboxylate |
| SMILES | C=C(C)C(=O)OC1CC(C(=O)OC2(CC)CCCCC2)C2CC1OC2=O |
| InChI | InChI=1S/C20H28O6/c1-4-20(8-6-5-7-9-20)26-19(23)14-11-15(24-17(21)12(2)3)16-10-13(14)18(22)25-16/h13-16H,2,4-11H2,1,3H3 |
| InChIKey | JLAADKBEBZXHER-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|