C17H24F2O6 — CID 122663896
2,2-difluoropropyl 4-(2,2-dimethylbutanoyloxy)-7-oxo-6-oxabicyclo[3.2.1]octane-2-carboxylate (PubChem CID 122663896) has the molecular formula C17H24F2O6 and a molecular weight of 362.37 g/mol. Its IUPAC name is 2,2-difluoropropyl 4-(2,2-dimethylbutanoyloxy)-7-oxo-6-oxabicyclo[3.2.1]octane-2-carboxylate.
| Compound Name | 2,2-difluoropropyl 4-(2,2-dimethylbutanoyloxy)-7-oxo-6-oxabicyclo[3.2.1]octane-2-carboxylate |
|---|---|
| PubChem CID | 122663896 |
| Molecular Formula | C17H24F2O6 |
| Molecular Weight | 362.37 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 2,2-difluoropropyl 4-(2,2-dimethylbutanoyloxy)-7-oxo-6-oxabicyclo[3.2.1]octane-2-carboxylate |
| SMILES | CCC(C)(C)C(=O)OC1CC(C(=O)OCC(C)(F)F)C2CC1OC2=O |
| InChI | InChI=1S/C17H24F2O6/c1-5-16(2,3)15(22)25-12-6-9(10-7-11(12)24-14(10)21)13(20)23-8-17(4,18)19/h9-12H,5-8H2,1-4H3 |
| InChIKey | XRMTVJWNAHTPNF-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.37 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|