C32H52 — CID 176838554
(4aS)-2,7-ditert-butyl-9-(2-cyclopentylhex-5-en-2-yl)-4,4a,4b,5,6,8a,9,9a-octahydro-3H-fluorene (PubChem CID 176838554) has the molecular formula C32H52 and a molecular weight of 436.77 g/mol. Its IUPAC name is (4aS)-2,7-ditert-butyl-9-(2-cyclopentylhex-5-en-2-yl)-4,4a,4b,5,6,8a,9,9a-octahydro-3H-fluorene.
| Compound Name | (4aS)-2,7-ditert-butyl-9-(2-cyclopentylhex-5-en-2-yl)-4,4a,4b,5,6,8a,9,9a-octahydro-3H-fluorene |
|---|---|
| PubChem CID | 176838554 |
| Molecular Formula | C32H52 |
| Molecular Weight | 436.77 g/mol |
| Exact Mass | 436.41 |
| IUPAC Name | (4aS)-2,7-ditert-butyl-9-(2-cyclopentylhex-5-en-2-yl)-4,4a,4b,5,6,8a,9,9a-octahydro-3H-fluorene |
| SMILES | C=CCCC(C)(C1CCCC1)C1C2C=C(C(C)(C)C)CCC2[C@@H]2CCC(C(C)(C)C)=CC12 |
| InChI | InChI=1S/C32H52/c1-9-10-19-32(8,22-13-11-12-14-22)29-27-20-23(30(2,3)4)15-17-25(27)26-18-16-24(21-28(26)29)31(5,6)7/h9,20-22,25-29H,1,10-19H2,2-8H3/t25-,26?,27?,28?,29?,32?/m0/s1 |
| InChIKey | GAVZWIZXMWTYKB-JRVHRHKGSA-N |
| XLogP | 9.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.77 |
| LogP ≤ 5 | 9.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|