About [benzoyloxy-(4-fluorophenyl)-λ3-iodanyl] benzoate
[benzoyloxy-(4-fluorophenyl)-λ3-iodanyl] benzoate (PubChem CID 176845295) has the molecular formula C20H14FIO4
and a molecular weight of 464.23 g/mol. Its IUPAC name is [benzoyloxy-(4-fluorophenyl)-λ3-iodanyl] benzoate.
Molecular Properties
| Compound Name | [benzoyloxy-(4-fluorophenyl)-λ3-iodanyl] benzoate |
| PubChem CID | 176845295 |
| Molecular Formula | C20H14FIO4 |
| Molecular Weight | 464.23 g/mol |
| Exact Mass | 463.99 |
| IUPAC Name | [benzoyloxy-(4-fluorophenyl)-λ3-iodanyl] benzoate |
| SMILES | O=C(OI(OC(=O)c1ccccc1)c1ccc(F)cc1)c1ccccc1 |
| InChI | InChI=1S/C20H14FIO4/c21-17-11-13-18(14-12-17)22(25-19(23)15-7-3-1-4-8-15)26-20(24)16-9-5-2-6-10-16/h1-14H |
| InChIKey | RCUDPEDWEQVSHC-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 464.23 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [benzoyloxy-(4-fluorophenyl)-λ3-iodanyl] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [benzoyloxy-(4-fluorophenyl)-λ3-iodanyl] benzoate?
The IUPAC name of [benzoyloxy-(4-fluorophenyl)-λ3-iodanyl] benzoate (CID 176845295) is [benzoyloxy-(4-fluorophenyl)-λ3-iodanyl] benzoate.
What is the SMILES notation for [benzoyloxy-(4-fluorophenyl)-λ3-iodanyl] benzoate?
The canonical SMILES for [benzoyloxy-(4-fluorophenyl)-λ3-iodanyl] benzoate is O=C(OI(OC(=O)c1ccccc1)c1ccc(F)cc1)c1ccccc1.
What is the InChIKey of [benzoyloxy-(4-fluorophenyl)-λ3-iodanyl] benzoate?
The InChIKey is RCUDPEDWEQVSHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14FIO4/c21-17-11-13-18(14-12-17)22(25-19(23)15-7-3-1-4-8-15)26-20(24)16-9-5-2-6-10-16/h1-14H.
What are the key properties of [benzoyloxy-(4-fluorophenyl)-λ3-iodanyl] benzoate?
[benzoyloxy-(4-fluorophenyl)-λ3-iodanyl] benzoate has a molecular weight of 464.23 g/mol, XLogP of 5.05, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [benzoyloxy-(4-fluorophenyl)-λ3-iodanyl] benzoate is sourced from PubChem (CID 176845295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).