About [(3-chlorobenzoyl)oxy-phenyl-λ3-iodanyl] 3-chlorobenzoate
[(3-chlorobenzoyl)oxy-phenyl-λ3-iodanyl] 3-chlorobenzoate (PubChem CID 135084757) has the molecular formula C20H13Cl2IO4
and a molecular weight of 515.13 g/mol. Its IUPAC name is [(3-chlorobenzoyl)oxy-phenyl-λ3-iodanyl] 3-chlorobenzoate.
Molecular Properties
| Compound Name | [(3-chlorobenzoyl)oxy-phenyl-λ3-iodanyl] 3-chlorobenzoate |
| PubChem CID | 135084757 |
| Molecular Formula | C20H13Cl2IO4 |
| Molecular Weight | 515.13 g/mol |
| Exact Mass | 513.92 |
| IUPAC Name | [(3-chlorobenzoyl)oxy-phenyl-λ3-iodanyl] 3-chlorobenzoate |
| SMILES | O=C(OI(OC(=O)c1cccc(Cl)c1)c1ccccc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C20H13Cl2IO4/c21-16-8-4-6-14(12-16)19(24)26-23(18-10-2-1-3-11-18)27-20(25)15-7-5-9-17(22)13-15/h1-13H |
| InChIKey | XJWGUCRNMMHREZ-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 515.13 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [(3-chlorobenzoyl)oxy-phenyl-λ3-iodanyl] 3-chlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3-chlorobenzoyl)oxy-phenyl-λ3-iodanyl] 3-chlorobenzoate?
The IUPAC name of [(3-chlorobenzoyl)oxy-phenyl-λ3-iodanyl] 3-chlorobenzoate (CID 135084757) is [(3-chlorobenzoyl)oxy-phenyl-λ3-iodanyl] 3-chlorobenzoate.
What is the SMILES notation for [(3-chlorobenzoyl)oxy-phenyl-λ3-iodanyl] 3-chlorobenzoate?
The canonical SMILES for [(3-chlorobenzoyl)oxy-phenyl-λ3-iodanyl] 3-chlorobenzoate is O=C(OI(OC(=O)c1cccc(Cl)c1)c1ccccc1)c1cccc(Cl)c1.
What is the InChIKey of [(3-chlorobenzoyl)oxy-phenyl-λ3-iodanyl] 3-chlorobenzoate?
The InChIKey is XJWGUCRNMMHREZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H13Cl2IO4/c21-16-8-4-6-14(12-16)19(24)26-23(18-10-2-1-3-11-18)27-20(25)15-7-5-9-17(22)13-15/h1-13H.
What are the key properties of [(3-chlorobenzoyl)oxy-phenyl-λ3-iodanyl] 3-chlorobenzoate?
[(3-chlorobenzoyl)oxy-phenyl-λ3-iodanyl] 3-chlorobenzoate has a molecular weight of 515.13 g/mol, XLogP of 6.21, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(3-chlorobenzoyl)oxy-phenyl-λ3-iodanyl] 3-chlorobenzoate is sourced from PubChem (CID 135084757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).