C21H17F3N4OS — CID 176849235
[7-phenyl-12-(trifluoromethyl)-10-thia-3,6,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-11-yl]-piperidin-1-ylmethanone (PubChem CID 176849235) has the molecular formula C21H17F3N4OS and a molecular weight of 430.46 g/mol. Its IUPAC name is [7-phenyl-12-(trifluoromethyl)-10-thia-3,6,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-11-yl]-piperidin-1-ylmethanone.
| Compound Name | [7-phenyl-12-(trifluoromethyl)-10-thia-3,6,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-11-yl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 176849235 |
| Molecular Formula | C21H17F3N4OS |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | [7-phenyl-12-(trifluoromethyl)-10-thia-3,6,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-11-yl]-piperidin-1-ylmethanone |
| SMILES | O=C(c1sc2nc(-c3ccccc3)n3ccnc3c2c1C(F)(F)F)N1CCCCC1 |
| InChI | InChI=1S/C21H17F3N4OS/c22-21(23,24)15-14-18-25-9-12-28(18)17(13-7-3-1-4-8-13)26-19(14)30-16(15)20(29)27-10-5-2-6-11-27/h1,3-4,7-9,12H,2,5-6,10-11H2 |
| InChIKey | KPQZYPQVFQHUPZ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |