C14H20F2N2O — CID 176849388
6-tert-butyl-2-(4,4-difluorocyclohexyl)pyridazin-3-one (PubChem CID 176849388) has the molecular formula C14H20F2N2O and a molecular weight of 270.32 g/mol. Its IUPAC name is 6-tert-butyl-2-(4,4-difluorocyclohexyl)pyridazin-3-one.
| Compound Name | 6-tert-butyl-2-(4,4-difluorocyclohexyl)pyridazin-3-one |
|---|---|
| PubChem CID | 176849388 |
| Molecular Formula | C14H20F2N2O |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 6-tert-butyl-2-(4,4-difluorocyclohexyl)pyridazin-3-one |
| SMILES | CC(C)(C)c1ccc(=O)n(C2CCC(F)(F)CC2)n1 |
| InChI | InChI=1S/C14H20F2N2O/c1-13(2,3)11-4-5-12(19)18(17-11)10-6-8-14(15,16)9-7-10/h4-5,10H,6-9H2,1-3H3 |
| InChIKey | MJQJCHYQGDSRRH-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |