C11H11F3N2O — CID 99819153
2-[(1S)-cyclohex-2-en-1-yl]-6-(trifluoromethyl)pyridazin-3-one (PubChem CID 99819153) has the molecular formula C11H11F3N2O and a molecular weight of 244.22 g/mol. Its IUPAC name is 2-[(1S)-cyclohex-2-en-1-yl]-6-(trifluoromethyl)pyridazin-3-one.
| Compound Name | 2-[(1S)-cyclohex-2-en-1-yl]-6-(trifluoromethyl)pyridazin-3-one |
|---|---|
| PubChem CID | 99819153 |
| Molecular Formula | C11H11F3N2O |
| Molecular Weight | 244.22 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 2-[(1S)-cyclohex-2-en-1-yl]-6-(trifluoromethyl)pyridazin-3-one |
| SMILES | O=c1ccc(C(F)(F)F)nn1[C@@H]1C=CCCC1 |
| InChI | InChI=1S/C11H11F3N2O/c12-11(13,14)9-6-7-10(17)16(15-9)8-4-2-1-3-5-8/h2,4,6-8H,1,3,5H2/t8-/m1/s1 |
| InChIKey | LMIPHYKKKHJZFL-MRVPVSSYSA-N |
| XLogP | 2.54 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.22 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|