C53H34N4 — CID 176849932
9-[4-anthracen-1-yl-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,2,3,4,5,7,8-heptadeuterio-6-(2,3,4,5,6-pentadeuteriophenyl)carbazole (PubChem CID 176849932) has the molecular formula C53H34N4 and a molecular weight of 738.96 g/mol. Its IUPAC name is 9-[4-anthracen-1-yl-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,2,3,4,5,7,8-heptadeuterio-6-(2,3,4,5,6-pentadeuteriophenyl)carbazole.
| Compound Name | 9-[4-anthracen-1-yl-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,2,3,4,5,7,8-heptadeuterio-6-(2,3,4,5,6-pentadeuteriophenyl)carbazole |
|---|---|
| PubChem CID | 176849932 |
| Molecular Formula | C53H34N4 |
| Molecular Weight | 738.96 g/mol |
| Exact Mass | 738.35 |
| IUPAC Name | 9-[4-anthracen-1-yl-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,2,3,4,5,7,8-heptadeuterio-6-(2,3,4,5,6-pentadeuteriophenyl)carbazole |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c([2H])c([2H])c3c(c2[2H])c2c([2H])c([2H])c([2H])c([2H])c2n3-c2ccc(-c3cccc4cc5ccccc5cc34)cc2-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)c([2H])c1[2H] |
| InChI | InChI=1S/C53H34N4/c1-4-15-35(16-5-1)40-27-29-49-46(33-40)44-24-12-13-26-48(44)57(49)50-30-28-42(43-25-14-23-41-31-38-21-10-11-22-39(38)32-45(41)43)34-47(50)53-55-51(36-17-6-2-7-18-36)54-52(56-53)37-19-8-3-9-20-37/h1-34H/i1D,4D,5D,12D,13D,15D,16D,24D,26D,27D,29D,33D |
| InChIKey | WQTNGYIICBDSCB-GALRZMNISA-N |
| XLogP | 13.61 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.96 |
| LogP ≤ 5 | 13.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|