C15H27NO2 — CID 176856922
[(1R,2S)-2-propan-2-ylcyclohexyl] piperidine-1-carboxylate (PubChem CID 176856922) has the molecular formula C15H27NO2 and a molecular weight of 253.39 g/mol. Its IUPAC name is [(1R,2S)-2-propan-2-ylcyclohexyl] piperidine-1-carboxylate.
| Compound Name | [(1R,2S)-2-propan-2-ylcyclohexyl] piperidine-1-carboxylate |
|---|---|
| PubChem CID | 176856922 |
| Molecular Formula | C15H27NO2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | [(1R,2S)-2-propan-2-ylcyclohexyl] piperidine-1-carboxylate |
| SMILES | CC(C)[C@@H]1CCCC[C@H]1OC(=O)N1CCCCC1 |
| InChI | InChI=1S/C15H27NO2/c1-12(2)13-8-4-5-9-14(13)18-15(17)16-10-6-3-7-11-16/h12-14H,3-11H2,1-2H3/t13-,14+/m0/s1 |
| InChIKey | YGBUMXFTGVMVDD-UONOGXRCSA-N |
| XLogP | 3.82 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |