C20H25N5O4 — CID 176858337
ethyl 1-[5-carbamoyl-4-(2-methoxyanilino)pyrimidin-2-yl]piperidine-4-carboxylate (PubChem CID 176858337) has the molecular formula C20H25N5O4 and a molecular weight of 399.45 g/mol. Its IUPAC name is ethyl 1-[5-carbamoyl-4-(2-methoxyanilino)pyrimidin-2-yl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[5-carbamoyl-4-(2-methoxyanilino)pyrimidin-2-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 176858337 |
| Molecular Formula | C20H25N5O4 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | ethyl 1-[5-carbamoyl-4-(2-methoxyanilino)pyrimidin-2-yl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2ncc(C(N)=O)c(Nc3ccccc3OC)n2)CC1 |
| InChI | InChI=1S/C20H25N5O4/c1-3-29-19(27)13-8-10-25(11-9-13)20-22-12-14(17(21)26)18(24-20)23-15-6-4-5-7-16(15)28-2/h4-7,12-13H,3,8-11H2,1-2H3,(H2,21,26)(H,22,23,24) |
| InChIKey | KFEPJYOMSHGDJG-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 119.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |