C21H18ClF2N5OS — CID 176863160
[2-(1,1-difluoroethyl)-1,3-thiazol-5-yl]-[(4S)-4-isoquinolin-3-yl-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]methanone;hydrochloride (PubChem CID 176863160) has the molecular formula C21H18ClF2N5OS and a molecular weight of 461.93 g/mol. Its IUPAC name is [2-(1,1-difluoroethyl)-1,3-thiazol-5-yl]-[(4S)-4-isoquinolin-3-yl-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]methanone;hydrochloride.
| Compound Name | [2-(1,1-difluoroethyl)-1,3-thiazol-5-yl]-[(4S)-4-isoquinolin-3-yl-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 176863160 |
| Molecular Formula | C21H18ClF2N5OS |
| Molecular Weight | 461.93 g/mol |
| Exact Mass | 461.09 |
| IUPAC Name | [2-(1,1-difluoroethyl)-1,3-thiazol-5-yl]-[(4S)-4-isoquinolin-3-yl-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]methanone;hydrochloride |
| SMILES | CC(F)(F)c1ncc(C(=O)N2CCc3nc[nH]c3[C@H]2c2cc3ccccc3cn2)s1.Cl |
| InChI | InChI=1S/C21H17F2N5OS.ClH/c1-21(22,23)20-25-10-16(30-20)19(29)28-7-6-14-17(27-11-26-14)18(28)15-8-12-4-2-3-5-13(12)9-24-15;/h2-5,8-11,18H,6-7H2,1H3,(H,26,27);1H/t18-;/m1./s1 |
| InChIKey | WJPUGDFBLPULLU-GMUIIQOCSA-N |
| XLogP | 4.74 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.93 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |