C18H12F3N5OS2 — CID 169167559
[(4S)-4-(1,3-benzothiazol-2-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone (PubChem CID 169167559) has the molecular formula C18H12F3N5OS2 and a molecular weight of 435.46 g/mol. Its IUPAC name is [(4S)-4-(1,3-benzothiazol-2-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone.
| Compound Name | [(4S)-4-(1,3-benzothiazol-2-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone |
|---|---|
| PubChem CID | 169167559 |
| Molecular Formula | C18H12F3N5OS2 |
| Molecular Weight | 435.46 g/mol |
| Exact Mass | 435.04 |
| IUPAC Name | [(4S)-4-(1,3-benzothiazol-2-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone |
| SMILES | O=C(c1cnc(C(F)(F)F)s1)N1CCc2[nH]cnc2[C@H]1c1nc2ccccc2s1 |
| InChI | InChI=1S/C18H12F3N5OS2/c19-18(20,21)17-22-7-12(29-17)16(27)26-6-5-10-13(24-8-23-10)14(26)15-25-9-3-1-2-4-11(9)28-15/h1-4,7-8,14H,5-6H2,(H,23,24)/t14-/m0/s1 |
| InChIKey | LTWNXQDSDIBXEV-AWEZNQCLSA-N |
| XLogP | 4.28 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.46 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |