C23H21F3N6O3S — CID 176763629
[(4S)-4-(1,3-benzothiazol-2-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-[2-(morpholin-4-ylmethyl)-4-(trifluoromethyl)-1,3-oxazol-5-yl]methanone (PubChem CID 176763629) has the molecular formula C23H21F3N6O3S and a molecular weight of 518.52 g/mol. Its IUPAC name is [(4S)-4-(1,3-benzothiazol-2-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-[2-(morpholin-4-ylmethyl)-4-(trifluoromethyl)-1,3-oxazol-5-yl]methanone.
| Compound Name | [(4S)-4-(1,3-benzothiazol-2-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-[2-(morpholin-4-ylmethyl)-4-(trifluoromethyl)-1,3-oxazol-5-yl]methanone |
|---|---|
| PubChem CID | 176763629 |
| Molecular Formula | C23H21F3N6O3S |
| Molecular Weight | 518.52 g/mol |
| Exact Mass | 518.13 |
| IUPAC Name | [(4S)-4-(1,3-benzothiazol-2-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-[2-(morpholin-4-ylmethyl)-4-(trifluoromethyl)-1,3-oxazol-5-yl]methanone |
| SMILES | O=C(c1oc(CN2CCOCC2)nc1C(F)(F)F)N1CCc2[nH]cnc2[C@H]1c1nc2ccccc2s1 |
| InChI | InChI=1S/C23H21F3N6O3S/c24-23(25,26)20-19(35-16(30-20)11-31-7-9-34-10-8-31)22(33)32-6-5-14-17(28-12-27-14)18(32)21-29-13-3-1-2-4-15(13)36-21/h1-4,12,18H,5-11H2,(H,27,28)/t18-/m0/s1 |
| InChIKey | RMSAENOTGSZQKB-SFHVURJKSA-N |
| XLogP | 3.65 |
| TPSA | 100.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.52 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |