C23H17N5OS2 — CID 169167470
[(4S)-4-(1,3-benzothiazol-2-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-(5-phenyl-1,3-thiazol-2-yl)methanone (PubChem CID 169167470) has the molecular formula C23H17N5OS2 and a molecular weight of 443.56 g/mol. Its IUPAC name is [(4S)-4-(1,3-benzothiazol-2-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-(5-phenyl-1,3-thiazol-2-yl)methanone.
| Compound Name | [(4S)-4-(1,3-benzothiazol-2-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-(5-phenyl-1,3-thiazol-2-yl)methanone |
|---|---|
| PubChem CID | 169167470 |
| Molecular Formula | C23H17N5OS2 |
| Molecular Weight | 443.56 g/mol |
| Exact Mass | 443.09 |
| IUPAC Name | [(4S)-4-(1,3-benzothiazol-2-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-(5-phenyl-1,3-thiazol-2-yl)methanone |
| SMILES | O=C(c1ncc(-c2ccccc2)s1)N1CCc2[nH]cnc2[C@H]1c1nc2ccccc2s1 |
| InChI | InChI=1S/C23H17N5OS2/c29-23(22-24-12-18(31-22)14-6-2-1-3-7-14)28-11-10-16-19(26-13-25-16)20(28)21-27-15-8-4-5-9-17(15)30-21/h1-9,12-13,20H,10-11H2,(H,25,26)/t20-/m0/s1 |
| InChIKey | QYZWLYWDZQGABA-FQEVSTJZSA-N |
| XLogP | 4.93 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.56 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |