C25H27N5OS2 — CID 169167068
[(4S)-4-(1,3-benzothiazol-2-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-[2-(4,4-dimethylcyclohexyl)-1,3-thiazol-5-yl]methanone (PubChem CID 169167068) has the molecular formula C25H27N5OS2 and a molecular weight of 477.66 g/mol. Its IUPAC name is [(4S)-4-(1,3-benzothiazol-2-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-[2-(4,4-dimethylcyclohexyl)-1,3-thiazol-5-yl]methanone.
| Compound Name | [(4S)-4-(1,3-benzothiazol-2-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-[2-(4,4-dimethylcyclohexyl)-1,3-thiazol-5-yl]methanone |
|---|---|
| PubChem CID | 169167068 |
| Molecular Formula | C25H27N5OS2 |
| Molecular Weight | 477.66 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | [(4S)-4-(1,3-benzothiazol-2-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-[2-(4,4-dimethylcyclohexyl)-1,3-thiazol-5-yl]methanone |
| SMILES | CC1(C)CCC(c2ncc(C(=O)N3CCc4[nH]cnc4[C@H]3c3nc4ccccc4s3)s2)CC1 |
| InChI | InChI=1S/C25H27N5OS2/c1-25(2)10-7-15(8-11-25)22-26-13-19(33-22)24(31)30-12-9-17-20(28-14-27-17)21(30)23-29-16-5-3-4-6-18(16)32-23/h3-6,13-15,21H,7-12H2,1-2H3,(H,27,28)/t21-/m0/s1 |
| InChIKey | CJQOYOYLPWEREH-NRFANRHFSA-N |
| XLogP | 5.95 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.66 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |