C19H19BrN2O4 — CID 176864383
[(Z)-1-aminoethylideneamino] 3-(8-bromo-3,6-dimethyl-4-oxochromen-2-yl)bicyclo[1.1.1]pentane-1-carboxylate (PubChem CID 176864383) has the molecular formula C19H19BrN2O4 and a molecular weight of 419.28 g/mol. Its IUPAC name is [(Z)-1-aminoethylideneamino] 3-(8-bromo-3,6-dimethyl-4-oxochromen-2-yl)bicyclo[1.1.1]pentane-1-carboxylate.
| Compound Name | [(Z)-1-aminoethylideneamino] 3-(8-bromo-3,6-dimethyl-4-oxochromen-2-yl)bicyclo[1.1.1]pentane-1-carboxylate |
|---|---|
| PubChem CID | 176864383 |
| Molecular Formula | C19H19BrN2O4 |
| Molecular Weight | 419.28 g/mol |
| Exact Mass | 418.05 |
| IUPAC Name | [(Z)-1-aminoethylideneamino] 3-(8-bromo-3,6-dimethyl-4-oxochromen-2-yl)bicyclo[1.1.1]pentane-1-carboxylate |
| SMILES | C/C(N)=N/OC(=O)C12CC(c3oc4c(Br)cc(C)cc4c(=O)c3C)(C1)C2 |
| InChI | InChI=1S/C19H19BrN2O4/c1-9-4-12-14(23)10(2)16(25-15(12)13(20)5-9)18-6-19(7-18,8-18)17(24)26-22-11(3)21/h4-5H,6-8H2,1-3H3,(H2,21,22) |
| InChIKey | RIJYPPFDZIJMIU-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 94.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.28 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|