C15H15BrClNO2 — CID 166035218
8-bromo-2-(4-chloropiperidin-1-yl)-6-methylchromen-4-one (PubChem CID 166035218) has the molecular formula C15H15BrClNO2 and a molecular weight of 356.65 g/mol. Its IUPAC name is 8-bromo-2-(4-chloropiperidin-1-yl)-6-methylchromen-4-one.
| Compound Name | 8-bromo-2-(4-chloropiperidin-1-yl)-6-methylchromen-4-one |
|---|---|
| PubChem CID | 166035218 |
| Molecular Formula | C15H15BrClNO2 |
| Molecular Weight | 356.65 g/mol |
| Exact Mass | 355.00 |
| IUPAC Name | 8-bromo-2-(4-chloropiperidin-1-yl)-6-methylchromen-4-one |
| SMILES | Cc1cc(Br)c2oc(N3CCC(Cl)CC3)cc(=O)c2c1 |
| InChI | InChI=1S/C15H15BrClNO2/c1-9-6-11-13(19)8-14(20-15(11)12(16)7-9)18-4-2-10(17)3-5-18/h6-8,10H,2-5H2,1H3 |
| InChIKey | NXMONQBOJJPWBG-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.65 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|