C26H30N2O5 — CID 166772815
methyl 2-[2-[2-(4-methoxypiperidin-1-yl)-6-methyl-4-oxochromen-8-yl]ethylamino]benzoate (PubChem CID 166772815) has the molecular formula C26H30N2O5 and a molecular weight of 450.54 g/mol. Its IUPAC name is methyl 2-[2-[2-(4-methoxypiperidin-1-yl)-6-methyl-4-oxochromen-8-yl]ethylamino]benzoate.
| Compound Name | methyl 2-[2-[2-(4-methoxypiperidin-1-yl)-6-methyl-4-oxochromen-8-yl]ethylamino]benzoate |
|---|---|
| PubChem CID | 166772815 |
| Molecular Formula | C26H30N2O5 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | methyl 2-[2-[2-(4-methoxypiperidin-1-yl)-6-methyl-4-oxochromen-8-yl]ethylamino]benzoate |
| SMILES | COC(=O)c1ccccc1NCCc1cc(C)cc2c(=O)cc(N3CCC(OC)CC3)oc12 |
| InChI | InChI=1S/C26H30N2O5/c1-17-14-18(8-11-27-22-7-5-4-6-20(22)26(30)32-3)25-21(15-17)23(29)16-24(33-25)28-12-9-19(31-2)10-13-28/h4-7,14-16,19,27H,8-13H2,1-3H3 |
| InChIKey | RAUIDMJQBXCCEB-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |