C24H25Cl4N7O4S — CID 176867286
[1-[[(5R)-2-[4-(5-chloropyrimidin-2-yl)-3,6-dihydro-2H-pyridin-1-yl]-5-oxo-6,7-dihydrothieno[3,2-d]pyrimidin-4-yl]amino]cyclopentyl]methyl N-(2,2,2-trichloroacetyl)carbamate (PubChem CID 176867286) has the molecular formula C24H25Cl4N7O4S and a molecular weight of 649.39 g/mol. Its IUPAC name is [1-[[(5R)-2-[4-(5-chloropyrimidin-2-yl)-3,6-dihydro-2H-pyridin-1-yl]-5-oxo-6,7-dihydrothieno[3,2-d]pyrimidin-4-yl]amino]cyclopentyl]methyl N-(2,2,2-trichloroacetyl)carbamate.
| Compound Name | [1-[[(5R)-2-[4-(5-chloropyrimidin-2-yl)-3,6-dihydro-2H-pyridin-1-yl]-5-oxo-6,7-dihydrothieno[3,2-d]pyrimidin-4-yl]amino]cyclopentyl]methyl N-(2,2,2-trichloroacetyl)carbamate |
|---|---|
| PubChem CID | 176867286 |
| Molecular Formula | C24H25Cl4N7O4S |
| Molecular Weight | 649.39 g/mol |
| Exact Mass | 647.04 |
| IUPAC Name | [1-[[(5R)-2-[4-(5-chloropyrimidin-2-yl)-3,6-dihydro-2H-pyridin-1-yl]-5-oxo-6,7-dihydrothieno[3,2-d]pyrimidin-4-yl]amino]cyclopentyl]methyl N-(2,2,2-trichloroacetyl)carbamate |
| SMILES | O=C(NC(=O)C(Cl)(Cl)Cl)OCC1(Nc2nc(N3CC=C(c4ncc(Cl)cn4)CC3)nc3c2[S@](=O)CC3)CCCC1 |
| InChI | InChI=1S/C24H25Cl4N7O4S/c25-15-11-29-18(30-12-15)14-3-8-35(9-4-14)21-31-16-5-10-40(38)17(16)19(32-21)34-23(6-1-2-7-23)13-39-22(37)33-20(36)24(26,27)28/h3,11-12H,1-2,4-10,13H2,(H,31,32,34)(H,33,36,37)/t40-/m1/s1 |
| InChIKey | BDELNMSJJROOHE-RRHRGVEJSA-N |
| XLogP | 4.23 |
| TPSA | 139.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.39 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|