C25H31ClN4O2S — CID 176867839
[2-[(5R)-2-[4-(4-chlorophenyl)piperidin-1-yl]-5-oxo-6,7-dihydrothieno[3,2-d]pyrimidin-4-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-3-yl]methanol (PubChem CID 176867839) has the molecular formula C25H31ClN4O2S and a molecular weight of 487.07 g/mol. Its IUPAC name is [2-[(5R)-2-[4-(4-chlorophenyl)piperidin-1-yl]-5-oxo-6,7-dihydrothieno[3,2-d]pyrimidin-4-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-3-yl]methanol.
| Compound Name | [2-[(5R)-2-[4-(4-chlorophenyl)piperidin-1-yl]-5-oxo-6,7-dihydrothieno[3,2-d]pyrimidin-4-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-3-yl]methanol |
|---|---|
| PubChem CID | 176867839 |
| Molecular Formula | C25H31ClN4O2S |
| Molecular Weight | 487.07 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | [2-[(5R)-2-[4-(4-chlorophenyl)piperidin-1-yl]-5-oxo-6,7-dihydrothieno[3,2-d]pyrimidin-4-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-3-yl]methanol |
| SMILES | O=[S@@]1CCc2nc(N3CCC(c4ccc(Cl)cc4)CC3)nc(N3CC4CCCC4C3CO)c21 |
| InChI | InChI=1S/C25H31ClN4O2S/c26-19-6-4-16(5-7-19)17-8-11-29(12-9-17)25-27-21-10-13-33(32)23(21)24(28-25)30-14-18-2-1-3-20(18)22(30)15-31/h4-7,17-18,20,22,31H,1-3,8-15H2/t18?,20?,22?,33-/m1/s1 |
| InChIKey | FTSPABBKSRVCMO-ZFXSTIETSA-N |
| XLogP | 3.77 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.07 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |