C15H26OS — CID 176868391
7,8-ditert-butyl-6λ4-thiaspiro[3.4]oct-7-ene 6-oxide (PubChem CID 176868391) has the molecular formula C15H26OS and a molecular weight of 254.44 g/mol. Its IUPAC name is 7,8-ditert-butyl-6λ4-thiaspiro[3.4]oct-7-ene 6-oxide.
| Compound Name | 7,8-ditert-butyl-6λ4-thiaspiro[3.4]oct-7-ene 6-oxide |
|---|---|
| PubChem CID | 176868391 |
| Molecular Formula | C15H26OS |
| Molecular Weight | 254.44 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | 7,8-ditert-butyl-6λ4-thiaspiro[3.4]oct-7-ene 6-oxide |
| SMILES | CC(C)(C)C1=C(C(C)(C)C)C2(CCC2)CS1=O |
| InChI | InChI=1S/C15H26OS/c1-13(2,3)11-12(14(4,5)6)17(16)10-15(11)8-7-9-15/h7-10H2,1-6H3 |
| InChIKey | YILKLIHAGQMTAU-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.44 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |