About 2,3-ditert-butyl-5,6-dihydro-4H-cyclopenta[b]thiophene 1-oxide
2,3-ditert-butyl-5,6-dihydro-4H-cyclopenta[b]thiophene 1-oxide (PubChem CID 176866308) has the molecular formula C15H24OS
and a molecular weight of 252.42 g/mol. Its IUPAC name is 2,3-ditert-butyl-5,6-dihydro-4H-cyclopenta[b]thiophene 1-oxide.
Analyze 2,3-ditert-butyl-5,6-dihydro-4H-cyclopenta[b]thiophene 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-ditert-butyl-5,6-dihydro-4H-cyclopenta[b]thiophene 1-oxide?
The IUPAC name of 2,3-ditert-butyl-5,6-dihydro-4H-cyclopenta[b]thiophene 1-oxide (CID 176866308) is 2,3-ditert-butyl-5,6-dihydro-4H-cyclopenta[b]thiophene 1-oxide.
What is the SMILES notation for 2,3-ditert-butyl-5,6-dihydro-4H-cyclopenta[b]thiophene 1-oxide?
The canonical SMILES for 2,3-ditert-butyl-5,6-dihydro-4H-cyclopenta[b]thiophene 1-oxide is CC(C)(C)C1=C(C(C)(C)C)S(=O)C2=C1CCC2.
What is the InChIKey of 2,3-ditert-butyl-5,6-dihydro-4H-cyclopenta[b]thiophene 1-oxide?
The InChIKey is IDWREOZWPDUWEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24OS/c1-14(2,3)12-10-8-7-9-11(10)17(16)13(12)15(4,5)6/h7-9H2,1-6H3.
What are the key properties of 2,3-ditert-butyl-5,6-dihydro-4H-cyclopenta[b]thiophene 1-oxide?
2,3-ditert-butyl-5,6-dihydro-4H-cyclopenta[b]thiophene 1-oxide has a molecular weight of 252.42 g/mol, XLogP of 4.53, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-ditert-butyl-5,6-dihydro-4H-cyclopenta[b]thiophene 1-oxide is sourced from PubChem (CID 176866308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).