C27H32N4O2S — CID 176869348
[1-[[(5R)-2-[5-(4-ethynylphenyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-5-oxo-7,8-dihydro-6H-thiopyrano[3,2-d]pyrimidin-4-yl]amino]cyclobutyl]methanol (PubChem CID 176869348) has the molecular formula C27H32N4O2S and a molecular weight of 476.65 g/mol. Its IUPAC name is [1-[[(5R)-2-[5-(4-ethynylphenyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-5-oxo-7,8-dihydro-6H-thiopyrano[3,2-d]pyrimidin-4-yl]amino]cyclobutyl]methanol.
| Compound Name | [1-[[(5R)-2-[5-(4-ethynylphenyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-5-oxo-7,8-dihydro-6H-thiopyrano[3,2-d]pyrimidin-4-yl]amino]cyclobutyl]methanol |
|---|---|
| PubChem CID | 176869348 |
| Molecular Formula | C27H32N4O2S |
| Molecular Weight | 476.65 g/mol |
| Exact Mass | 476.22 |
| IUPAC Name | [1-[[(5R)-2-[5-(4-ethynylphenyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-5-oxo-7,8-dihydro-6H-thiopyrano[3,2-d]pyrimidin-4-yl]amino]cyclobutyl]methanol |
| SMILES | C#Cc1ccc(C2CC3CN(c4nc5c(c(NC6(CO)CCC6)n4)[S@](=O)CCC5)CC3C2)cc1 |
| InChI | InChI=1S/C27H32N4O2S/c1-2-18-6-8-19(9-7-18)20-13-21-15-31(16-22(21)14-20)26-28-23-5-3-12-34(33)24(23)25(29-26)30-27(17-32)10-4-11-27/h1,6-9,20-22,32H,3-5,10-17H2,(H,28,29,30)/t20?,21?,22?,34-/m1/s1 |
| InChIKey | MKSWVUAOVHTIEV-XVDNRSKNSA-N |
| XLogP | 3.47 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.65 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|