C25H35N8O4P — CID 176870152
propyl 2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-[[(1R)-1-(4-isocyanophenyl)ethyl]amino]phosphoryl]amino]-2-methylpropanoate (PubChem CID 176870152) has the molecular formula C25H35N8O4P and a molecular weight of 542.58 g/mol. Its IUPAC name is propyl 2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-[[(1R)-1-(4-isocyanophenyl)ethyl]amino]phosphoryl]amino]-2-methylpropanoate.
| Compound Name | propyl 2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-[[(1R)-1-(4-isocyanophenyl)ethyl]amino]phosphoryl]amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 176870152 |
| Molecular Formula | C25H35N8O4P |
| Molecular Weight | 542.58 g/mol |
| Exact Mass | 542.25 |
| IUPAC Name | propyl 2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-[[(1R)-1-(4-isocyanophenyl)ethyl]amino]phosphoryl]amino]-2-methylpropanoate |
| SMILES | [C-]#[N+]c1ccc([C@@H](C)N[P@@](=O)(CO[C@H](C)Cn2cnc3c(N)ncnc32)NC(C)(C)C(=O)OCCC)cc1 |
| InChI | InChI=1S/C25H35N8O4P/c1-7-12-36-24(34)25(4,5)32-38(35,31-18(3)19-8-10-20(27-6)11-9-19)16-37-17(2)13-33-15-30-21-22(26)28-14-29-23(21)33/h8-11,14-15,17-18H,7,12-13,16H2,1-5H3,(H2,26,28,29)(H2,31,32,35)/t17-,18-,38+/m1/s1 |
| InChIKey | HLRHIUVIEOWBGA-GOWUVSFMSA-N |
| XLogP | 4.19 |
| TPSA | 150.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.58 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|