C32H55N2O5+ — CID 176872518
[1-[1,3-di(decanoyloxy)propan-2-ylamino]-1-oxo-3-phenylpropan-2-yl]azanium (PubChem CID 176872518) has the molecular formula C32H55N2O5+ and a molecular weight of 547.80 g/mol. Its IUPAC name is [1-[1,3-di(decanoyloxy)propan-2-ylamino]-1-oxo-3-phenylpropan-2-yl]azanium.
| Compound Name | [1-[1,3-di(decanoyloxy)propan-2-ylamino]-1-oxo-3-phenylpropan-2-yl]azanium |
|---|---|
| PubChem CID | 176872518 |
| Molecular Formula | C32H55N2O5+ |
| Molecular Weight | 547.80 g/mol |
| Exact Mass | 547.41 |
| IUPAC Name | [1-[1,3-di(decanoyloxy)propan-2-ylamino]-1-oxo-3-phenylpropan-2-yl]azanium |
| SMILES | CCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCC)NC(=O)C([NH3+])Cc1ccccc1 |
| InChI | InChI=1S/C32H54N2O5/c1-3-5-7-9-11-13-18-22-30(35)38-25-28(26-39-31(36)23-19-14-12-10-8-6-4-2)34-32(37)29(33)24-27-20-16-15-17-21-27/h15-17,20-21,28-29H,3-14,18-19,22-26,33H2,1-2H3,(H,34,37)/p+1 |
| InChIKey | FDUYIVXCSWKHTF-UHFFFAOYSA-O |
| XLogP | 5.69 |
| TPSA | 109.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.80 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|