C33H57N2O5+ — CID 176872451
[1-[bis(2-decanoyloxyethyl)amino]-1-oxo-3-phenylpropan-2-yl]azanium (PubChem CID 176872451) has the molecular formula C33H57N2O5+ and a molecular weight of 561.83 g/mol. Its IUPAC name is [1-[bis(2-decanoyloxyethyl)amino]-1-oxo-3-phenylpropan-2-yl]azanium.
| Compound Name | [1-[bis(2-decanoyloxyethyl)amino]-1-oxo-3-phenylpropan-2-yl]azanium |
|---|---|
| PubChem CID | 176872451 |
| Molecular Formula | C33H57N2O5+ |
| Molecular Weight | 561.83 g/mol |
| Exact Mass | 561.43 |
| IUPAC Name | [1-[bis(2-decanoyloxyethyl)amino]-1-oxo-3-phenylpropan-2-yl]azanium |
| SMILES | CCCCCCCCCC(=O)OCCN(CCOC(=O)CCCCCCCCC)C(=O)C([NH3+])Cc1ccccc1 |
| InChI | InChI=1S/C33H56N2O5/c1-3-5-7-9-11-13-18-22-31(36)39-26-24-35(33(38)30(34)28-29-20-16-15-17-21-29)25-27-40-32(37)23-19-14-12-10-8-6-4-2/h15-17,20-21,30H,3-14,18-19,22-28,34H2,1-2H3/p+1 |
| InChIKey | GDNFUXNNGPYVHV-UHFFFAOYSA-O |
| XLogP | 6.04 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.83 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|