C30H56N4O5+2 — CID 176872392
[1-[bis(2-decanoyloxyethyl)amino]-3-(1H-imidazol-1-ium-4-yl)-1-oxopropan-2-yl]azanium (PubChem CID 176872392) has the molecular formula C30H56N4O5+2 and a molecular weight of 552.80 g/mol. Its IUPAC name is [1-[bis(2-decanoyloxyethyl)amino]-3-(1H-imidazol-1-ium-4-yl)-1-oxopropan-2-yl]azanium.
| Compound Name | [1-[bis(2-decanoyloxyethyl)amino]-3-(1H-imidazol-1-ium-4-yl)-1-oxopropan-2-yl]azanium |
|---|---|
| PubChem CID | 176872392 |
| Molecular Formula | C30H56N4O5+2 |
| Molecular Weight | 552.80 g/mol |
| Exact Mass | 552.42 |
| IUPAC Name | [1-[bis(2-decanoyloxyethyl)amino]-3-(1H-imidazol-1-ium-4-yl)-1-oxopropan-2-yl]azanium |
| SMILES | CCCCCCCCCC(=O)OCCN(CCOC(=O)CCCCCCCCC)C(=O)C([NH3+])CC1=C[NH2+]C=N1 |
| InChI | InChI=1S/C30H54N4O5/c1-3-5-7-9-11-13-15-17-28(35)38-21-19-34(30(37)27(31)23-26-24-32-25-33-26)20-22-39-29(36)18-16-14-12-10-8-6-4-2/h24-25,27H,3-23,31H2,1-2H3,(H,32,33)/p+2 |
| InChIKey | JOCZTIDSLVLVRN-UHFFFAOYSA-P |
| XLogP | 3.63 |
| TPSA | 129.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.80 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|