C46H82N4O5 — CID 176872447
2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]-[2-[(Z)-octadec-9-enoyl]oxyethyl]amino]ethyl (Z)-octadec-9-enoate (PubChem CID 176872447) has the molecular formula C46H82N4O5 and a molecular weight of 771.19 g/mol. Its IUPAC name is 2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]-[2-[(Z)-octadec-9-enoyl]oxyethyl]amino]ethyl (Z)-octadec-9-enoate.
| Compound Name | 2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]-[2-[(Z)-octadec-9-enoyl]oxyethyl]amino]ethyl (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 176872447 |
| Molecular Formula | C46H82N4O5 |
| Molecular Weight | 771.19 g/mol |
| Exact Mass | 770.63 |
| IUPAC Name | 2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]-[2-[(Z)-octadec-9-enoyl]oxyethyl]amino]ethyl (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OCCN(CCOC(=O)CCCCCCC/C=C\CCCCCCCC)C(=O)C(N)Cc1cnc[nH]1 |
| InChI | InChI=1S/C46H82N4O5/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-44(51)54-37-35-50(46(53)43(47)39-42-40-48-41-49-42)36-38-55-45(52)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20,40-41,43H,3-16,21-39,47H2,1-2H3,(H,48,49)/b19-17-,20-18- |
| InChIKey | SSBCUQDHOVQQJD-CLFAGFIQSA-N |
| XLogP | 11.27 |
| TPSA | 127.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.19 |
| LogP ≤ 5 | 11.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|