C35H60N2O6 — CID 176872803
2-[2-decanoyloxyethyl-[2-(2-hydroxyethylamino)-3-phenylpropanoyl]amino]ethyl decanoate (PubChem CID 176872803) has the molecular formula C35H60N2O6 and a molecular weight of 604.87 g/mol. Its IUPAC name is 2-[2-decanoyloxyethyl-[2-(2-hydroxyethylamino)-3-phenylpropanoyl]amino]ethyl decanoate.
| Compound Name | 2-[2-decanoyloxyethyl-[2-(2-hydroxyethylamino)-3-phenylpropanoyl]amino]ethyl decanoate |
|---|---|
| PubChem CID | 176872803 |
| Molecular Formula | C35H60N2O6 |
| Molecular Weight | 604.87 g/mol |
| Exact Mass | 604.45 |
| IUPAC Name | 2-[2-decanoyloxyethyl-[2-(2-hydroxyethylamino)-3-phenylpropanoyl]amino]ethyl decanoate |
| SMILES | CCCCCCCCCC(=O)OCCN(CCOC(=O)CCCCCCCCC)C(=O)C(Cc1ccccc1)NCCO |
| InChI | InChI=1S/C35H60N2O6/c1-3-5-7-9-11-13-18-22-33(39)42-28-25-37(26-29-43-34(40)23-19-14-12-10-8-6-4-2)35(41)32(36-24-27-38)30-31-20-16-15-17-21-31/h15-17,20-21,32,36,38H,3-14,18-19,22-30H2,1-2H3 |
| InChIKey | FRESMOBIPLEBQK-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.87 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|