C24H25N8OS+ — CID 176873847
2-[1-[[3-[5-(3-aminoprop-1-ynyl)pyrimidin-2-yl]-1H-imidazol-3-ium-5-yl]methyl]piperidin-3-yl]-4-thiophen-2-yl-1H-pyrimidin-6-one (PubChem CID 176873847) has the molecular formula C24H25N8OS+ and a molecular weight of 473.59 g/mol. Its IUPAC name is 2-[1-[[3-[5-(3-aminoprop-1-ynyl)pyrimidin-2-yl]-1H-imidazol-3-ium-5-yl]methyl]piperidin-3-yl]-4-thiophen-2-yl-1H-pyrimidin-6-one.
| Compound Name | 2-[1-[[3-[5-(3-aminoprop-1-ynyl)pyrimidin-2-yl]-1H-imidazol-3-ium-5-yl]methyl]piperidin-3-yl]-4-thiophen-2-yl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 176873847 |
| Molecular Formula | C24H25N8OS+ |
| Molecular Weight | 473.59 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | 2-[1-[[3-[5-(3-aminoprop-1-ynyl)pyrimidin-2-yl]-1H-imidazol-3-ium-5-yl]methyl]piperidin-3-yl]-4-thiophen-2-yl-1H-pyrimidin-6-one |
| SMILES | NCC#Cc1cnc(-[n+]2c[nH]c(CN3CCCC(c4nc(-c5cccs5)cc(=O)[nH]4)C3)c2)nc1 |
| InChI | InChI=1S/C24H24N8OS/c25-7-1-4-17-11-26-24(27-12-17)32-15-19(28-16-32)14-31-8-2-5-18(13-31)23-29-20(10-22(33)30-23)21-6-3-9-34-21/h3,6,9-12,15-16,18H,2,5,7-8,13-14,25H2,(H,29,30,33)/p+1 |
| InChIKey | HWKSWKSPXXMZQW-UHFFFAOYSA-O |
| XLogP | 1.58 |
| TPSA | 120.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.59 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|