C60H42F8N8 — CID 176876828
1-N,3-N,6-N,8-N-tetrakis(3,5-difluorophenyl)-1-N,3-N,6-N,8-N-tetrakis(2-methylpyrrol-1-yl)pyrene-1,3,6,8-tetramine (PubChem CID 176876828) has the molecular formula C60H42F8N8 and a molecular weight of 1027.04 g/mol. Its IUPAC name is 1-N,3-N,6-N,8-N-tetrakis(3,5-difluorophenyl)-1-N,3-N,6-N,8-N-tetrakis(2-methylpyrrol-1-yl)pyrene-1,3,6,8-tetramine.
| Compound Name | 1-N,3-N,6-N,8-N-tetrakis(3,5-difluorophenyl)-1-N,3-N,6-N,8-N-tetrakis(2-methylpyrrol-1-yl)pyrene-1,3,6,8-tetramine |
|---|---|
| PubChem CID | 176876828 |
| Molecular Formula | C60H42F8N8 |
| Molecular Weight | 1027.04 g/mol |
| Exact Mass | 1026.34 |
| IUPAC Name | 1-N,3-N,6-N,8-N-tetrakis(3,5-difluorophenyl)-1-N,3-N,6-N,8-N-tetrakis(2-methylpyrrol-1-yl)pyrene-1,3,6,8-tetramine |
| SMILES | Cc1cccn1N(c1cc(F)cc(F)c1)c1cc(N(c2cc(F)cc(F)c2)n2cccc2C)c2ccc3c(N(c4cc(F)cc(F)c4)n4cccc4C)cc(N(c4cc(F)cc(F)c4)n4cccc4C)c4ccc1c2c43 |
| InChI | InChI=1S/C60H42F8N8/c1-35-9-5-17-69(35)73(47-25-39(61)21-40(62)26-47)55-33-56(74(70-18-6-10-36(70)2)48-27-41(63)22-42(64)28-48)52-15-16-54-58(76(72-20-8-12-38(72)4)50-31-45(67)24-46(68)32-50)34-57(53-14-13-51(55)59(52)60(53)54)75(71-19-7-11-37(71)3)49-29-43(65)23-44(66)30-49/h5-34H,1-4H3 |
| InChIKey | MKHKPTCWEQLFDB-UHFFFAOYSA-N |
| XLogP | 16.54 |
| TPSA | 32.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1027.04 |
| LogP ≤ 5 | 16.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|