C28H31F2N3O6S — CID 176878900
4-[(1R)-1-[5-(cyclopropylmethoxy)-2-pyridinyl]propoxy]-2,3-difluoro-N-[4-[2-(methylamino)ethoxy]phenyl]sulfonylbenzamide (PubChem CID 176878900) has the molecular formula C28H31F2N3O6S and a molecular weight of 575.63 g/mol. Its IUPAC name is 4-[(1R)-1-[5-(cyclopropylmethoxy)-2-pyridinyl]propoxy]-2,3-difluoro-N-[4-[2-(methylamino)ethoxy]phenyl]sulfonylbenzamide.
| Compound Name | 4-[(1R)-1-[5-(cyclopropylmethoxy)-2-pyridinyl]propoxy]-2,3-difluoro-N-[4-[2-(methylamino)ethoxy]phenyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 176878900 |
| Molecular Formula | C28H31F2N3O6S |
| Molecular Weight | 575.63 g/mol |
| Exact Mass | 575.19 |
| IUPAC Name | 4-[(1R)-1-[5-(cyclopropylmethoxy)-2-pyridinyl]propoxy]-2,3-difluoro-N-[4-[2-(methylamino)ethoxy]phenyl]sulfonylbenzamide |
| SMILES | CC[C@@H](Oc1ccc(C(=O)NS(=O)(=O)c2ccc(OCCNC)cc2)c(F)c1F)c1ccc(OCC2CC2)cn1 |
| InChI | InChI=1S/C28H31F2N3O6S/c1-3-24(23-12-8-20(16-32-23)38-17-18-4-5-18)39-25-13-11-22(26(29)27(25)30)28(34)33-40(35,36)21-9-6-19(7-10-21)37-15-14-31-2/h6-13,16,18,24,31H,3-5,14-15,17H2,1-2H3,(H,33,34)/t24-/m1/s1 |
| InChIKey | DRHVSQMWGHSLTM-XMMPIXPASA-N |
| XLogP | 4.40 |
| TPSA | 115.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.63 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|