C25H42N2O4 — CID 176880645
3-[(E)-3-[4-[3-(1-methylpiperidin-4-yl)propyl]piperidin-1-yl]prop-2-enoyl]oxybutyl (E)-but-2-enoate (PubChem CID 176880645) has the molecular formula C25H42N2O4 and a molecular weight of 434.62 g/mol. Its IUPAC name is 3-[(E)-3-[4-[3-(1-methylpiperidin-4-yl)propyl]piperidin-1-yl]prop-2-enoyl]oxybutyl (E)-but-2-enoate.
| Compound Name | 3-[(E)-3-[4-[3-(1-methylpiperidin-4-yl)propyl]piperidin-1-yl]prop-2-enoyl]oxybutyl (E)-but-2-enoate |
|---|---|
| PubChem CID | 176880645 |
| Molecular Formula | C25H42N2O4 |
| Molecular Weight | 434.62 g/mol |
| Exact Mass | 434.31 |
| IUPAC Name | 3-[(E)-3-[4-[3-(1-methylpiperidin-4-yl)propyl]piperidin-1-yl]prop-2-enoyl]oxybutyl (E)-but-2-enoate |
| SMILES | C/C=C/C(=O)OCCC(C)OC(=O)/C=C/N1CCC(CCCC2CCN(C)CC2)CC1 |
| InChI | InChI=1S/C25H42N2O4/c1-4-6-24(28)30-20-14-21(2)31-25(29)13-19-27-17-11-23(12-18-27)8-5-7-22-9-15-26(3)16-10-22/h4,6,13,19,21-23H,5,7-12,14-18,20H2,1-3H3/b6-4+,19-13+ |
| InChIKey | ZIDVPYWJQSXSOW-FGXIKOFLSA-N |
| XLogP | 4.17 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.62 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|