C16H26N2O4 — CID 176880473
3-[(E)-3-(4-methylpiperazin-1-yl)prop-2-enoyl]oxybutyl (E)-but-2-enoate (PubChem CID 176880473) has the molecular formula C16H26N2O4 and a molecular weight of 310.39 g/mol. Its IUPAC name is 3-[(E)-3-(4-methylpiperazin-1-yl)prop-2-enoyl]oxybutyl (E)-but-2-enoate.
| Compound Name | 3-[(E)-3-(4-methylpiperazin-1-yl)prop-2-enoyl]oxybutyl (E)-but-2-enoate |
|---|---|
| PubChem CID | 176880473 |
| Molecular Formula | C16H26N2O4 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | 3-[(E)-3-(4-methylpiperazin-1-yl)prop-2-enoyl]oxybutyl (E)-but-2-enoate |
| SMILES | C/C=C/C(=O)OCCC(C)OC(=O)/C=C/N1CCN(C)CC1 |
| InChI | InChI=1S/C16H26N2O4/c1-4-5-15(19)21-13-7-14(2)22-16(20)6-8-18-11-9-17(3)10-12-18/h4-6,8,14H,7,9-13H2,1-3H3/b5-4+,8-6+ |
| InChIKey | WTSZBRFOHDHQLP-DVBIZMGNSA-N |
| XLogP | 1.19 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|