C20H34N2O7 — CID 176880631
2-[2-[2-[2-[(E)-3-(4-methylpiperazin-1-yl)prop-2-enoyl]oxyethoxy]ethoxy]ethoxy]ethyl (E)-but-2-enoate (PubChem CID 176880631) has the molecular formula C20H34N2O7 and a molecular weight of 414.50 g/mol. Its IUPAC name is 2-[2-[2-[2-[(E)-3-(4-methylpiperazin-1-yl)prop-2-enoyl]oxyethoxy]ethoxy]ethoxy]ethyl (E)-but-2-enoate.
| Compound Name | 2-[2-[2-[2-[(E)-3-(4-methylpiperazin-1-yl)prop-2-enoyl]oxyethoxy]ethoxy]ethoxy]ethyl (E)-but-2-enoate |
|---|---|
| PubChem CID | 176880631 |
| Molecular Formula | C20H34N2O7 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | 2-[2-[2-[2-[(E)-3-(4-methylpiperazin-1-yl)prop-2-enoyl]oxyethoxy]ethoxy]ethoxy]ethyl (E)-but-2-enoate |
| SMILES | C/C=C/C(=O)OCCOCCOCCOCCOC(=O)/C=C/N1CCN(C)CC1 |
| InChI | InChI=1S/C20H34N2O7/c1-3-4-19(23)28-17-15-26-13-11-25-12-14-27-16-18-29-20(24)5-6-22-9-7-21(2)8-10-22/h3-6H,7-18H2,1-2H3/b4-3+,6-5+ |
| InChIKey | WIJQKVAIOULTDO-VNKDHWASSA-N |
| XLogP | 0.46 |
| TPSA | 86.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|